C17H13FN2OS — CID 53269402
(E)-N-(4-fluoro-1,3-benzothiazol-2-yl)-3-(4-methylphenyl)prop-2-enamide (PubChem CID 53269402) has the molecular formula C17H13FN2OS and a molecular weight of 312.37 g/mol. Its IUPAC name is (E)-N-(4-fluoro-1,3-benzothiazol-2-yl)-3-(4-methylphenyl)prop-2-enamide.
| Compound Name | (E)-N-(4-fluoro-1,3-benzothiazol-2-yl)-3-(4-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 53269402 |
| Molecular Formula | C17H13FN2OS |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | (E)-N-(4-fluoro-1,3-benzothiazol-2-yl)-3-(4-methylphenyl)prop-2-enamide |
| SMILES | Cc1ccc(/C=C/C(=O)Nc2nc3c(F)cccc3s2)cc1 |
| InChI | InChI=1S/C17H13FN2OS/c1-11-5-7-12(8-6-11)9-10-15(21)19-17-20-16-13(18)3-2-4-14(16)22-17/h2-10H,1H3,(H,19,20,21)/b10-9+ |
| InChIKey | AFHJYIROZFPCIJ-MDZDMXLPSA-N |
| XLogP | 4.40 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|