C18H14BrFN2O2S — CID 53269312
(E)-3-(5-bromo-2-ethoxyphenyl)-N-(4-fluoro-1,3-benzothiazol-2-yl)prop-2-enamide (PubChem CID 53269312) has the molecular formula C18H14BrFN2O2S and a molecular weight of 421.29 g/mol. Its IUPAC name is (E)-3-(5-bromo-2-ethoxyphenyl)-N-(4-fluoro-1,3-benzothiazol-2-yl)prop-2-enamide.
| Compound Name | (E)-3-(5-bromo-2-ethoxyphenyl)-N-(4-fluoro-1,3-benzothiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 53269312 |
| Molecular Formula | C18H14BrFN2O2S |
| Molecular Weight | 421.29 g/mol |
| Exact Mass | 419.99 |
| IUPAC Name | (E)-3-(5-bromo-2-ethoxyphenyl)-N-(4-fluoro-1,3-benzothiazol-2-yl)prop-2-enamide |
| SMILES | CCOc1ccc(Br)cc1/C=C/C(=O)Nc1nc2c(F)cccc2s1 |
| InChI | InChI=1S/C18H14BrFN2O2S/c1-2-24-14-8-7-12(19)10-11(14)6-9-16(23)21-18-22-17-13(20)4-3-5-15(17)25-18/h3-10H,2H2,1H3,(H,21,22,23)/b9-6+ |
| InChIKey | XKNQBVIRVPJXLJ-RMKNXTFCSA-N |
| XLogP | 5.25 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.29 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|