C18H17N3O7S — CID 2918411
ethyl 4-methyl-2-[[2-[3-(4-nitrophenyl)prop-2-enoyloxy]acetyl]amino]-1,3-thiazole-5-carboxylate (PubChem CID 2918411) has the molecular formula C18H17N3O7S and a molecular weight of 419.42 g/mol. Its IUPAC name is ethyl 4-methyl-2-[[2-[3-(4-nitrophenyl)prop-2-enoyloxy]acetyl]amino]-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 4-methyl-2-[[2-[3-(4-nitrophenyl)prop-2-enoyloxy]acetyl]amino]-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 2918411 |
| Molecular Formula | C18H17N3O7S |
| Molecular Weight | 419.42 g/mol |
| Exact Mass | 419.08 |
| IUPAC Name | ethyl 4-methyl-2-[[2-[3-(4-nitrophenyl)prop-2-enoyloxy]acetyl]amino]-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1sc(NC(=O)COC(=O)C=Cc2ccc([N+](=O)[O-])cc2)nc1C |
| InChI | InChI=1S/C18H17N3O7S/c1-3-27-17(24)16-11(2)19-18(29-16)20-14(22)10-28-15(23)9-6-12-4-7-13(8-5-12)21(25)26/h4-9H,3,10H2,1-2H3,(H,19,20,22) |
| InChIKey | GCRLHKNFVMYDHD-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 137.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.42 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|