C27H20IN3O2S — CID 24950863
(4-iodophenyl)methyl 2-(3,5-diphenylpyrazol-1-yl)-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 24950863) has the molecular formula C27H20IN3O2S and a molecular weight of 577.45 g/mol. Its IUPAC name is (4-iodophenyl)methyl 2-(3,5-diphenylpyrazol-1-yl)-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | (4-iodophenyl)methyl 2-(3,5-diphenylpyrazol-1-yl)-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 24950863 |
| Molecular Formula | C27H20IN3O2S |
| Molecular Weight | 577.45 g/mol |
| Exact Mass | 577.03 |
| IUPAC Name | (4-iodophenyl)methyl 2-(3,5-diphenylpyrazol-1-yl)-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | Cc1nc(-n2nc(-c3ccccc3)cc2-c2ccccc2)sc1C(=O)OCc1ccc(I)cc1 |
| InChI | InChI=1S/C27H20IN3O2S/c1-18-25(26(32)33-17-19-12-14-22(28)15-13-19)34-27(29-18)31-24(21-10-6-3-7-11-21)16-23(30-31)20-8-4-2-5-9-20/h2-16H,17H2,1H3 |
| InChIKey | CAFGERQFRVZFIJ-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.45 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|