C23H17N3S — CID 86163173
2-(3,5-diphenylpyrazol-1-yl)-6-methyl-1,3-benzothiazole (PubChem CID 86163173) has the molecular formula C23H17N3S and a molecular weight of 367.48 g/mol. Its IUPAC name is 2-(3,5-diphenylpyrazol-1-yl)-6-methyl-1,3-benzothiazole.
| Compound Name | 2-(3,5-diphenylpyrazol-1-yl)-6-methyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 86163173 |
| Molecular Formula | C23H17N3S |
| Molecular Weight | 367.48 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | 2-(3,5-diphenylpyrazol-1-yl)-6-methyl-1,3-benzothiazole |
| SMILES | Cc1ccc2nc(-n3nc(-c4ccccc4)cc3-c3ccccc3)sc2c1 |
| InChI | InChI=1S/C23H17N3S/c1-16-12-13-19-22(14-16)27-23(24-19)26-21(18-10-6-3-7-11-18)15-20(25-26)17-8-4-2-5-9-17/h2-15H,1H3 |
| InChIKey | LPWIVXKLGUJGIW-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.48 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |