C31H21N5O3 — CID 3444886
2-cyano-3-[4-(3,5-diphenylpyrazol-1-yl)phenyl]-N-(4-nitrophenyl)prop-2-enamide (PubChem CID 3444886) has the molecular formula C31H21N5O3 and a molecular weight of 511.54 g/mol. Its IUPAC name is 2-cyano-3-[4-(3,5-diphenylpyrazol-1-yl)phenyl]-N-(4-nitrophenyl)prop-2-enamide.
| Compound Name | 2-cyano-3-[4-(3,5-diphenylpyrazol-1-yl)phenyl]-N-(4-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 3444886 |
| Molecular Formula | C31H21N5O3 |
| Molecular Weight | 511.54 g/mol |
| Exact Mass | 511.16 |
| IUPAC Name | 2-cyano-3-[4-(3,5-diphenylpyrazol-1-yl)phenyl]-N-(4-nitrophenyl)prop-2-enamide |
| SMILES | N#CC(=Cc1ccc(-n2nc(-c3ccccc3)cc2-c2ccccc2)cc1)C(=O)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C31H21N5O3/c32-21-25(31(37)33-26-13-17-28(18-14-26)36(38)39)19-22-11-15-27(16-12-22)35-30(24-9-5-2-6-10-24)20-29(34-35)23-7-3-1-4-8-23/h1-20H,(H,33,37) |
| InChIKey | LMXICJNSUFDLPW-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 113.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.54 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|