C20H17ClN2OS — CID 154585267
(E)-3-(4-chlorophenyl)-1-[2-(2-ethyl-4-pyridinyl)-4-methyl-1,3-thiazol-5-yl]prop-2-en-1-one (PubChem CID 154585267) has the molecular formula C20H17ClN2OS and a molecular weight of 368.89 g/mol. Its IUPAC name is (E)-3-(4-chlorophenyl)-1-[2-(2-ethyl-4-pyridinyl)-4-methyl-1,3-thiazol-5-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(4-chlorophenyl)-1-[2-(2-ethyl-4-pyridinyl)-4-methyl-1,3-thiazol-5-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 154585267 |
| Molecular Formula | C20H17ClN2OS |
| Molecular Weight | 368.89 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | (E)-3-(4-chlorophenyl)-1-[2-(2-ethyl-4-pyridinyl)-4-methyl-1,3-thiazol-5-yl]prop-2-en-1-one |
| SMILES | CCc1cc(-c2nc(C)c(C(=O)/C=C/c3ccc(Cl)cc3)s2)ccn1 |
| InChI | InChI=1S/C20H17ClN2OS/c1-3-17-12-15(10-11-22-17)20-23-13(2)19(25-20)18(24)9-6-14-4-7-16(21)8-5-14/h4-12H,3H2,1-2H3/b9-6+ |
| InChIKey | OASAVLAJPQSIHV-RMKNXTFCSA-N |
| XLogP | 5.63 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.89 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|