C16H10Cl2N2O2S — CID 86667472
4-[(4-chlorophenyl)methyl]-2-(2-chloro-4-pyridinyl)-1,3-thiazole-5-carboxylic acid (PubChem CID 86667472) has the molecular formula C16H10Cl2N2O2S and a molecular weight of 365.24 g/mol. Its IUPAC name is 4-[(4-chlorophenyl)methyl]-2-(2-chloro-4-pyridinyl)-1,3-thiazole-5-carboxylic acid.
| Compound Name | 4-[(4-chlorophenyl)methyl]-2-(2-chloro-4-pyridinyl)-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 86667472 |
| Molecular Formula | C16H10Cl2N2O2S |
| Molecular Weight | 365.24 g/mol |
| Exact Mass | 363.98 |
| IUPAC Name | 4-[(4-chlorophenyl)methyl]-2-(2-chloro-4-pyridinyl)-1,3-thiazole-5-carboxylic acid |
| SMILES | O=C(O)c1sc(-c2ccnc(Cl)c2)nc1Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H10Cl2N2O2S/c17-11-3-1-9(2-4-11)7-12-14(16(21)22)23-15(20-12)10-5-6-19-13(18)8-10/h1-6,8H,7H2,(H,21,22) |
| InChIKey | WZMRKOOFEWMKHT-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.24 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|