C20H18FN3O2S — CID 135846526
2-(4-fluorophenyl)-N-[(E)-1-[2-(4-hydroxyphenyl)-4-methyl-1,3-thiazol-5-yl]ethylideneamino]acetamide (PubChem CID 135846526) has the molecular formula C20H18FN3O2S and a molecular weight of 383.45 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N-[(E)-1-[2-(4-hydroxyphenyl)-4-methyl-1,3-thiazol-5-yl]ethylideneamino]acetamide.
| Compound Name | 2-(4-fluorophenyl)-N-[(E)-1-[2-(4-hydroxyphenyl)-4-methyl-1,3-thiazol-5-yl]ethylideneamino]acetamide |
|---|---|
| PubChem CID | 135846526 |
| Molecular Formula | C20H18FN3O2S |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | 2-(4-fluorophenyl)-N-[(E)-1-[2-(4-hydroxyphenyl)-4-methyl-1,3-thiazol-5-yl]ethylideneamino]acetamide |
| SMILES | C/C(=N\NC(=O)Cc1ccc(F)cc1)c1sc(-c2ccc(O)cc2)nc1C |
| InChI | InChI=1S/C20H18FN3O2S/c1-12-19(27-20(22-12)15-5-9-17(25)10-6-15)13(2)23-24-18(26)11-14-3-7-16(21)8-4-14/h3-10,25H,11H2,1-2H3,(H,24,26)/b23-13+ |
| InChIKey | LSDCUZDFGHKPKN-YDZHTSKRSA-N |
| XLogP | 4.05 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|