C13H14FN5OS — CID 172935807
1-[(E)-1-[2-(5-fluoro-3-pyridinyl)-4-methyl-1,3-thiazol-5-yl]ethylideneamino]-3-methylurea (PubChem CID 172935807) has the molecular formula C13H14FN5OS and a molecular weight of 307.35 g/mol. Its IUPAC name is 1-[(E)-1-[2-(5-fluoro-3-pyridinyl)-4-methyl-1,3-thiazol-5-yl]ethylideneamino]-3-methylurea.
| Compound Name | 1-[(E)-1-[2-(5-fluoro-3-pyridinyl)-4-methyl-1,3-thiazol-5-yl]ethylideneamino]-3-methylurea |
|---|---|
| PubChem CID | 172935807 |
| Molecular Formula | C13H14FN5OS |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | 1-[(E)-1-[2-(5-fluoro-3-pyridinyl)-4-methyl-1,3-thiazol-5-yl]ethylideneamino]-3-methylurea |
| SMILES | CNC(=O)N/N=C(\C)c1sc(-c2cncc(F)c2)nc1C |
| InChI | InChI=1S/C13H14FN5OS/c1-7-11(8(2)18-19-13(20)15-3)21-12(17-7)9-4-10(14)6-16-5-9/h4-6H,1-3H3,(H2,15,19,20)/b18-8+ |
| InChIKey | RVZBZQIVCTXREJ-QGMBQPNBSA-N |
| XLogP | 2.31 |
| TPSA | 79.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|