C13H14FN3OS2 — CID 126635044
N-[2-(5-fluoro-3-pyridinyl)-4-methyl-1,3-thiazol-5-yl]-2-methyl-3-sulfanylpropanamide (PubChem CID 126635044) has the molecular formula C13H14FN3OS2 and a molecular weight of 311.41 g/mol. Its IUPAC name is N-[2-(5-fluoro-3-pyridinyl)-4-methyl-1,3-thiazol-5-yl]-2-methyl-3-sulfanylpropanamide.
| Compound Name | N-[2-(5-fluoro-3-pyridinyl)-4-methyl-1,3-thiazol-5-yl]-2-methyl-3-sulfanylpropanamide |
|---|---|
| PubChem CID | 126635044 |
| Molecular Formula | C13H14FN3OS2 |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | N-[2-(5-fluoro-3-pyridinyl)-4-methyl-1,3-thiazol-5-yl]-2-methyl-3-sulfanylpropanamide |
| SMILES | Cc1nc(-c2cncc(F)c2)sc1NC(=O)C(C)CS |
| InChI | InChI=1S/C13H14FN3OS2/c1-7(6-19)11(18)17-12-8(2)16-13(20-12)9-3-10(14)5-15-4-9/h3-5,7,19H,6H2,1-2H3,(H,17,18) |
| InChIKey | RDYGCBOFDMXDDI-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|