C14H16ClN3OS2 — CID 59580462
N-[2-(6-chloro-3-pyridinyl)-4-methyl-1,3-thiazol-5-yl]-2-methyl-3-methylsulfanylpropanamide (PubChem CID 59580462) has the molecular formula C14H16ClN3OS2 and a molecular weight of 341.89 g/mol. Its IUPAC name is N-[2-(6-chloro-3-pyridinyl)-4-methyl-1,3-thiazol-5-yl]-2-methyl-3-methylsulfanylpropanamide.
| Compound Name | N-[2-(6-chloro-3-pyridinyl)-4-methyl-1,3-thiazol-5-yl]-2-methyl-3-methylsulfanylpropanamide |
|---|---|
| PubChem CID | 59580462 |
| Molecular Formula | C14H16ClN3OS2 |
| Molecular Weight | 341.89 g/mol |
| Exact Mass | 341.04 |
| IUPAC Name | N-[2-(6-chloro-3-pyridinyl)-4-methyl-1,3-thiazol-5-yl]-2-methyl-3-methylsulfanylpropanamide |
| SMILES | CSCC(C)C(=O)Nc1sc(-c2ccc(Cl)nc2)nc1C |
| InChI | InChI=1S/C14H16ClN3OS2/c1-8(7-20-3)12(19)18-13-9(2)17-14(21-13)10-4-5-11(15)16-6-10/h4-6,8H,7H2,1-3H3,(H,18,19) |
| InChIKey | GIJSDXWJXVICOZ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.89 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|