C14H16FN3OS2 — CID 126635494
N-[2-(5-fluoro-3-pyridinyl)-4-methyl-1,3-thiazol-5-yl]-N,2-dimethyl-3-sulfanylpropanamide (PubChem CID 126635494) has the molecular formula C14H16FN3OS2 and a molecular weight of 325.43 g/mol. Its IUPAC name is N-[2-(5-fluoro-3-pyridinyl)-4-methyl-1,3-thiazol-5-yl]-N,2-dimethyl-3-sulfanylpropanamide.
| Compound Name | N-[2-(5-fluoro-3-pyridinyl)-4-methyl-1,3-thiazol-5-yl]-N,2-dimethyl-3-sulfanylpropanamide |
|---|---|
| PubChem CID | 126635494 |
| Molecular Formula | C14H16FN3OS2 |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | N-[2-(5-fluoro-3-pyridinyl)-4-methyl-1,3-thiazol-5-yl]-N,2-dimethyl-3-sulfanylpropanamide |
| SMILES | Cc1nc(-c2cncc(F)c2)sc1N(C)C(=O)C(C)CS |
| InChI | InChI=1S/C14H16FN3OS2/c1-8(7-20)13(19)18(3)14-9(2)17-12(21-14)10-4-11(15)6-16-5-10/h4-6,8,20H,7H2,1-3H3 |
| InChIKey | ASJSYJMQDQMJRM-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|