C19H19F4N3OS2 — CID 118029824
N-[2-(5-fluoro-3-pyridinyl)-4-methyl-1,3-thiazol-5-yl]-2-methyl-N-prop-2-ynyl-3-(3,3,3-trifluoropropylsulfanyl)propanamide (PubChem CID 118029824) has the molecular formula C19H19F4N3OS2 and a molecular weight of 445.51 g/mol. Its IUPAC name is N-[2-(5-fluoro-3-pyridinyl)-4-methyl-1,3-thiazol-5-yl]-2-methyl-N-prop-2-ynyl-3-(3,3,3-trifluoropropylsulfanyl)propanamide.
| Compound Name | N-[2-(5-fluoro-3-pyridinyl)-4-methyl-1,3-thiazol-5-yl]-2-methyl-N-prop-2-ynyl-3-(3,3,3-trifluoropropylsulfanyl)propanamide |
|---|---|
| PubChem CID | 118029824 |
| Molecular Formula | C19H19F4N3OS2 |
| Molecular Weight | 445.51 g/mol |
| Exact Mass | 445.09 |
| IUPAC Name | N-[2-(5-fluoro-3-pyridinyl)-4-methyl-1,3-thiazol-5-yl]-2-methyl-N-prop-2-ynyl-3-(3,3,3-trifluoropropylsulfanyl)propanamide |
| SMILES | C#CCN(C(=O)C(C)CSCCC(F)(F)F)c1sc(-c2cncc(F)c2)nc1C |
| InChI | InChI=1S/C19H19F4N3OS2/c1-4-6-26(17(27)12(2)11-28-7-5-19(21,22)23)18-13(3)25-16(29-18)14-8-15(20)10-24-9-14/h1,8-10,12H,5-7,11H2,2-3H3 |
| InChIKey | SJYMGKXAKSKLFC-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.51 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|