C9H6FIN2S — CID 118944509
2-(5-fluoro-3-pyridinyl)-4-iodo-5-methyl-1,3-thiazole (PubChem CID 118944509) has the molecular formula C9H6FIN2S and a molecular weight of 320.13 g/mol. Its IUPAC name is 2-(5-fluoro-3-pyridinyl)-4-iodo-5-methyl-1,3-thiazole.
| Compound Name | 2-(5-fluoro-3-pyridinyl)-4-iodo-5-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 118944509 |
| Molecular Formula | C9H6FIN2S |
| Molecular Weight | 320.13 g/mol |
| Exact Mass | 319.93 |
| IUPAC Name | 2-(5-fluoro-3-pyridinyl)-4-iodo-5-methyl-1,3-thiazole |
| SMILES | Cc1sc(-c2cncc(F)c2)nc1I |
| InChI | InChI=1S/C9H6FIN2S/c1-5-8(11)13-9(14-5)6-2-7(10)4-12-3-6/h2-4H,1H3 |
| InChIKey | HGQLJCIPZAGKOG-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.13 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|