About 2-(3,5-difluorophenyl)-4,5-dimethyl-1,3-thiazole
2-(3,5-difluorophenyl)-4,5-dimethyl-1,3-thiazole (PubChem CID 58992623) has the molecular formula C11H9F2NS
and a molecular weight of 225.26 g/mol. Its IUPAC name is 2-(3,5-difluorophenyl)-4,5-dimethyl-1,3-thiazole.
Molecular Properties
| Compound Name | 2-(3,5-difluorophenyl)-4,5-dimethyl-1,3-thiazole |
| PubChem CID | 58992623 |
| Molecular Formula | C11H9F2NS |
| Molecular Weight | 225.26 g/mol |
| Exact Mass | 225.04 |
| IUPAC Name | 2-(3,5-difluorophenyl)-4,5-dimethyl-1,3-thiazole |
| SMILES | Cc1nc(-c2cc(F)cc(F)c2)sc1C |
| InChI | InChI=1S/C11H9F2NS/c1-6-7(2)15-11(14-6)8-3-9(12)5-10(13)4-8/h3-5H,1-2H3 |
| InChIKey | RTTRLMAGCQUTQY-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.26 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(3,5-difluorophenyl)-4,5-dimethyl-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,5-difluorophenyl)-4,5-dimethyl-1,3-thiazole?
The IUPAC name of 2-(3,5-difluorophenyl)-4,5-dimethyl-1,3-thiazole (CID 58992623) is 2-(3,5-difluorophenyl)-4,5-dimethyl-1,3-thiazole.
What is the SMILES notation for 2-(3,5-difluorophenyl)-4,5-dimethyl-1,3-thiazole?
The canonical SMILES for 2-(3,5-difluorophenyl)-4,5-dimethyl-1,3-thiazole is Cc1nc(-c2cc(F)cc(F)c2)sc1C.
What is the InChIKey of 2-(3,5-difluorophenyl)-4,5-dimethyl-1,3-thiazole?
The InChIKey is RTTRLMAGCQUTQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9F2NS/c1-6-7(2)15-11(14-6)8-3-9(12)5-10(13)4-8/h3-5H,1-2H3.
What are the key properties of 2-(3,5-difluorophenyl)-4,5-dimethyl-1,3-thiazole?
2-(3,5-difluorophenyl)-4,5-dimethyl-1,3-thiazole has a molecular weight of 225.26 g/mol, XLogP of 3.71, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,5-difluorophenyl)-4,5-dimethyl-1,3-thiazole is sourced from PubChem (CID 58992623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).