C18H22N4O2S2 — CID 135846398
1-[(E)-1-[2-(4-hydroxyphenyl)-4-methyl-1,3-thiazol-5-yl]ethylideneamino]-3-[[(2S)-oxolan-2-yl]methyl]thiourea (PubChem CID 135846398) has the molecular formula C18H22N4O2S2 and a molecular weight of 390.53 g/mol. Its IUPAC name is 1-[(E)-1-[2-(4-hydroxyphenyl)-4-methyl-1,3-thiazol-5-yl]ethylideneamino]-3-[[(2S)-oxolan-2-yl]methyl]thiourea.
| Compound Name | 1-[(E)-1-[2-(4-hydroxyphenyl)-4-methyl-1,3-thiazol-5-yl]ethylideneamino]-3-[[(2S)-oxolan-2-yl]methyl]thiourea |
|---|---|
| PubChem CID | 135846398 |
| Molecular Formula | C18H22N4O2S2 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | 1-[(E)-1-[2-(4-hydroxyphenyl)-4-methyl-1,3-thiazol-5-yl]ethylideneamino]-3-[[(2S)-oxolan-2-yl]methyl]thiourea |
| SMILES | C/C(=N\NC(=S)NC[C@@H]1CCCO1)c1sc(-c2ccc(O)cc2)nc1C |
| InChI | InChI=1S/C18H22N4O2S2/c1-11-16(26-17(20-11)13-5-7-14(23)8-6-13)12(2)21-22-18(25)19-10-15-4-3-9-24-15/h5-8,15,23H,3-4,9-10H2,1-2H3,(H2,19,22,25)/b21-12+/t15-/m0/s1 |
| InChIKey | JONSYNUAXVHPBL-NGZBARDMSA-N |
| XLogP | 3.19 |
| TPSA | 78.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|