C19H20N3O4S- — CID 9409970
5-[4-[(Z)-C-methyl-N-[[(2R)-oxolan-2-yl]methylcarbamothioylamino]carbonimidoyl]phenyl]furan-2-carboxylate (PubChem CID 9409970) has the molecular formula C19H20N3O4S- and a molecular weight of 386.45 g/mol. Its IUPAC name is 5-[4-[(Z)-C-methyl-N-[[(2R)-oxolan-2-yl]methylcarbamothioylamino]carbonimidoyl]phenyl]furan-2-carboxylate.
| Compound Name | 5-[4-[(Z)-C-methyl-N-[[(2R)-oxolan-2-yl]methylcarbamothioylamino]carbonimidoyl]phenyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 9409970 |
| Molecular Formula | C19H20N3O4S- |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | 5-[4-[(Z)-C-methyl-N-[[(2R)-oxolan-2-yl]methylcarbamothioylamino]carbonimidoyl]phenyl]furan-2-carboxylate |
| SMILES | C/C(=N/NC(=S)NC[C@H]1CCCO1)c1ccc(-c2ccc(C(=O)[O-])o2)cc1 |
| InChI | InChI=1S/C19H21N3O4S/c1-12(21-22-19(27)20-11-15-3-2-10-25-15)13-4-6-14(7-5-13)16-8-9-17(26-16)18(23)24/h4-9,15H,2-3,10-11H2,1H3,(H,23,24)(H2,20,22,27)/p-1/b21-12-/t15-/m1/s1 |
| InChIKey | SOLVUTDICNYEAQ-OFNOZLENSA-M |
| XLogP | 1.68 |
| TPSA | 98.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|