C17H26N4O3S2 — CID 9409892
1-[[(2S)-oxolan-2-yl]methyl]-3-[(Z)-1-[4-(propylsulfamoyl)phenyl]ethylideneamino]thiourea (PubChem CID 9409892) has the molecular formula C17H26N4O3S2 and a molecular weight of 398.55 g/mol. Its IUPAC name is 1-[[(2S)-oxolan-2-yl]methyl]-3-[(Z)-1-[4-(propylsulfamoyl)phenyl]ethylideneamino]thiourea.
| Compound Name | 1-[[(2S)-oxolan-2-yl]methyl]-3-[(Z)-1-[4-(propylsulfamoyl)phenyl]ethylideneamino]thiourea |
|---|---|
| PubChem CID | 9409892 |
| Molecular Formula | C17H26N4O3S2 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | 1-[[(2S)-oxolan-2-yl]methyl]-3-[(Z)-1-[4-(propylsulfamoyl)phenyl]ethylideneamino]thiourea |
| SMILES | CCCNS(=O)(=O)c1ccc(/C(C)=N\NC(=S)NC[C@@H]2CCCO2)cc1 |
| InChI | InChI=1S/C17H26N4O3S2/c1-3-10-19-26(22,23)16-8-6-14(7-9-16)13(2)20-21-17(25)18-12-15-5-4-11-24-15/h6-9,15,19H,3-5,10-12H2,1-2H3,(H2,18,21,25)/b20-13-/t15-/m0/s1 |
| InChIKey | LIDFUAZSBCYNCY-HYTQYMIGSA-N |
| XLogP | 1.74 |
| TPSA | 91.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|