C17H22N4OS2 — CID 135846497
1-tert-butyl-3-[(E)-1-[2-(4-hydroxyphenyl)-4-methyl-1,3-thiazol-5-yl]ethylideneamino]thiourea (PubChem CID 135846497) has the molecular formula C17H22N4OS2 and a molecular weight of 362.52 g/mol. Its IUPAC name is 1-tert-butyl-3-[(E)-1-[2-(4-hydroxyphenyl)-4-methyl-1,3-thiazol-5-yl]ethylideneamino]thiourea.
| Compound Name | 1-tert-butyl-3-[(E)-1-[2-(4-hydroxyphenyl)-4-methyl-1,3-thiazol-5-yl]ethylideneamino]thiourea |
|---|---|
| PubChem CID | 135846497 |
| Molecular Formula | C17H22N4OS2 |
| Molecular Weight | 362.52 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | 1-tert-butyl-3-[(E)-1-[2-(4-hydroxyphenyl)-4-methyl-1,3-thiazol-5-yl]ethylideneamino]thiourea |
| SMILES | C/C(=N\NC(=S)NC(C)(C)C)c1sc(-c2ccc(O)cc2)nc1C |
| InChI | InChI=1S/C17H22N4OS2/c1-10-14(11(2)20-21-16(23)19-17(3,4)5)24-15(18-10)12-6-8-13(22)9-7-12/h6-9,22H,1-5H3,(H2,19,21,23)/b20-11+ |
| InChIKey | AOGCWPCTDZOUBP-RGVLZGJSSA-N |
| XLogP | 3.81 |
| TPSA | 69.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.52 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|