C19H27N5S — CID 122498759
N"-[(E)-1-[2-(4-cyclohexylphenyl)-4-methyl-1,3-thiazol-5-yl]ethylideneamino]methanetriamine (PubChem CID 122498759) has the molecular formula C19H27N5S and a molecular weight of 357.53 g/mol. Its IUPAC name is N"-[(E)-1-[2-(4-cyclohexylphenyl)-4-methyl-1,3-thiazol-5-yl]ethylideneamino]methanetriamine.
| Compound Name | N"-[(E)-1-[2-(4-cyclohexylphenyl)-4-methyl-1,3-thiazol-5-yl]ethylideneamino]methanetriamine |
|---|---|
| PubChem CID | 122498759 |
| Molecular Formula | C19H27N5S |
| Molecular Weight | 357.53 g/mol |
| Exact Mass | 357.20 |
| IUPAC Name | N"-[(E)-1-[2-(4-cyclohexylphenyl)-4-methyl-1,3-thiazol-5-yl]ethylideneamino]methanetriamine |
| SMILES | C/C(=N\NC(N)N)c1sc(-c2ccc(C3CCCCC3)cc2)nc1C |
| InChI | InChI=1S/C19H27N5S/c1-12-17(13(2)23-24-19(20)21)25-18(22-12)16-10-8-15(9-11-16)14-6-4-3-5-7-14/h8-11,14,19,24H,3-7,20-21H2,1-2H3/b23-13+ |
| InChIKey | GPMIZDMROVDIIT-YDZHTSKRSA-N |
| XLogP | 3.68 |
| TPSA | 89.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.53 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|