C10H10FN3S — CID 116887765
[2-(4-fluorophenyl)-4-methyl-1,3-thiazol-5-yl]hydrazine (PubChem CID 116887765) has the molecular formula C10H10FN3S and a molecular weight of 223.28 g/mol. Its IUPAC name is [2-(4-fluorophenyl)-4-methyl-1,3-thiazol-5-yl]hydrazine.
| Compound Name | [2-(4-fluorophenyl)-4-methyl-1,3-thiazol-5-yl]hydrazine |
|---|---|
| PubChem CID | 116887765 |
| Molecular Formula | C10H10FN3S |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.06 |
| IUPAC Name | [2-(4-fluorophenyl)-4-methyl-1,3-thiazol-5-yl]hydrazine |
| SMILES | Cc1nc(-c2ccc(F)cc2)sc1NN |
| InChI | InChI=1S/C10H10FN3S/c1-6-9(14-12)15-10(13-6)7-2-4-8(11)5-3-7/h2-5,14H,12H2,1H3 |
| InChIKey | HPMFCTQOOMMAGJ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|