C13H14N4S — CID 116887806
[4-methyl-2-(2-methyl-1H-indol-3-yl)-1,3-thiazol-5-yl]hydrazine (PubChem CID 116887806) has the molecular formula C13H14N4S and a molecular weight of 258.35 g/mol. Its IUPAC name is [4-methyl-2-(2-methyl-1H-indol-3-yl)-1,3-thiazol-5-yl]hydrazine.
| Compound Name | [4-methyl-2-(2-methyl-1H-indol-3-yl)-1,3-thiazol-5-yl]hydrazine |
|---|---|
| PubChem CID | 116887806 |
| Molecular Formula | C13H14N4S |
| Molecular Weight | 258.35 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | [4-methyl-2-(2-methyl-1H-indol-3-yl)-1,3-thiazol-5-yl]hydrazine |
| SMILES | Cc1nc(-c2c(C)[nH]c3ccccc23)sc1NN |
| InChI | InChI=1S/C13H14N4S/c1-7-11(9-5-3-4-6-10(9)15-7)13-16-8(2)12(17-14)18-13/h3-6,15,17H,14H2,1-2H3 |
| InChIKey | BIOPAGCPRNHJEX-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.35 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|