C12H12N4S — CID 116892094
[2-(2-methyl-1H-indol-3-yl)-1,3-thiazol-4-yl]hydrazine (PubChem CID 116892094) has the molecular formula C12H12N4S and a molecular weight of 244.32 g/mol. Its IUPAC name is [2-(2-methyl-1H-indol-3-yl)-1,3-thiazol-4-yl]hydrazine.
| Compound Name | [2-(2-methyl-1H-indol-3-yl)-1,3-thiazol-4-yl]hydrazine |
|---|---|
| PubChem CID | 116892094 |
| Molecular Formula | C12H12N4S |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | [2-(2-methyl-1H-indol-3-yl)-1,3-thiazol-4-yl]hydrazine |
| SMILES | Cc1[nH]c2ccccc2c1-c1nc(NN)cs1 |
| InChI | InChI=1S/C12H12N4S/c1-7-11(12-15-10(16-13)6-17-12)8-4-2-3-5-9(8)14-7/h2-6,14,16H,13H2,1H3 |
| InChIKey | OKQMEXDQPPMYRE-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|