C18H13ClN2S — CID 102490378
2-(5-chloro-2-methyl-1H-indol-3-yl)-4-phenyl-1,3-thiazole (PubChem CID 102490378) has the molecular formula C18H13ClN2S and a molecular weight of 324.84 g/mol. Its IUPAC name is 2-(5-chloro-2-methyl-1H-indol-3-yl)-4-phenyl-1,3-thiazole.
| Compound Name | 2-(5-chloro-2-methyl-1H-indol-3-yl)-4-phenyl-1,3-thiazole |
|---|---|
| PubChem CID | 102490378 |
| Molecular Formula | C18H13ClN2S |
| Molecular Weight | 324.84 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | 2-(5-chloro-2-methyl-1H-indol-3-yl)-4-phenyl-1,3-thiazole |
| SMILES | Cc1[nH]c2ccc(Cl)cc2c1-c1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C18H13ClN2S/c1-11-17(14-9-13(19)7-8-15(14)20-11)18-21-16(10-22-18)12-5-3-2-4-6-12/h2-10,20H,1H3 |
| InChIKey | LFEXSNXKQFHODP-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.84 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |