About [4-methyl-2-(4-propan-2-ylphenyl)-1,3-thiazol-5-yl]hydrazine
[4-methyl-2-(4-propan-2-ylphenyl)-1,3-thiazol-5-yl]hydrazine (PubChem CID 116887760) has the molecular formula C13H17N3S
and a molecular weight of 247.37 g/mol. Its IUPAC name is [4-methyl-2-(4-propan-2-ylphenyl)-1,3-thiazol-5-yl]hydrazine.
Molecular Properties
| Compound Name | [4-methyl-2-(4-propan-2-ylphenyl)-1,3-thiazol-5-yl]hydrazine |
| PubChem CID | 116887760 |
| Molecular Formula | C13H17N3S |
| Molecular Weight | 247.37 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | [4-methyl-2-(4-propan-2-ylphenyl)-1,3-thiazol-5-yl]hydrazine |
| SMILES | Cc1nc(-c2ccc(C(C)C)cc2)sc1NN |
| InChI | InChI=1S/C13H17N3S/c1-8(2)10-4-6-11(7-5-10)13-15-9(3)12(16-14)17-13/h4-8,16H,14H2,1-3H3 |
| InChIKey | OFLACQQZFWVHLK-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.37 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [4-methyl-2-(4-propan-2-ylphenyl)-1,3-thiazol-5-yl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-methyl-2-(4-propan-2-ylphenyl)-1,3-thiazol-5-yl]hydrazine?
The IUPAC name of [4-methyl-2-(4-propan-2-ylphenyl)-1,3-thiazol-5-yl]hydrazine (CID 116887760) is [4-methyl-2-(4-propan-2-ylphenyl)-1,3-thiazol-5-yl]hydrazine.
What is the SMILES notation for [4-methyl-2-(4-propan-2-ylphenyl)-1,3-thiazol-5-yl]hydrazine?
The canonical SMILES for [4-methyl-2-(4-propan-2-ylphenyl)-1,3-thiazol-5-yl]hydrazine is Cc1nc(-c2ccc(C(C)C)cc2)sc1NN.
What is the InChIKey of [4-methyl-2-(4-propan-2-ylphenyl)-1,3-thiazol-5-yl]hydrazine?
The InChIKey is OFLACQQZFWVHLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N3S/c1-8(2)10-4-6-11(7-5-10)13-15-9(3)12(16-14)17-13/h4-8,16H,14H2,1-3H3.
What are the key properties of [4-methyl-2-(4-propan-2-ylphenyl)-1,3-thiazol-5-yl]hydrazine?
[4-methyl-2-(4-propan-2-ylphenyl)-1,3-thiazol-5-yl]hydrazine has a molecular weight of 247.37 g/mol, XLogP of 3.53, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-methyl-2-(4-propan-2-ylphenyl)-1,3-thiazol-5-yl]hydrazine is sourced from PubChem (CID 116887760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).