C17H13NO4S2 — CID 7668495
(4-methoxycarbonylphenyl) 4-methyl-2-thiophen-2-yl-1,3-thiazole-5-carboxylate (PubChem CID 7668495) has the molecular formula C17H13NO4S2 and a molecular weight of 359.43 g/mol. Its IUPAC name is (4-methoxycarbonylphenyl) 4-methyl-2-thiophen-2-yl-1,3-thiazole-5-carboxylate.
| Compound Name | (4-methoxycarbonylphenyl) 4-methyl-2-thiophen-2-yl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 7668495 |
| Molecular Formula | C17H13NO4S2 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.03 |
| IUPAC Name | (4-methoxycarbonylphenyl) 4-methyl-2-thiophen-2-yl-1,3-thiazole-5-carboxylate |
| SMILES | COC(=O)c1ccc(OC(=O)c2sc(-c3cccs3)nc2C)cc1 |
| InChI | InChI=1S/C17H13NO4S2/c1-10-14(24-15(18-10)13-4-3-9-23-13)17(20)22-12-7-5-11(6-8-12)16(19)21-2/h3-9H,1-2H3 |
| InChIKey | PEBMGPQOYJGFIN-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|