C15H15N3O4S2 — CID 27747926
[2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] 4-methyl-2-thiophen-2-yl-1,3-thiazole-5-carboxylate (PubChem CID 27747926) has the molecular formula C15H15N3O4S2 and a molecular weight of 365.44 g/mol. Its IUPAC name is [2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] 4-methyl-2-thiophen-2-yl-1,3-thiazole-5-carboxylate.
| Compound Name | [2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] 4-methyl-2-thiophen-2-yl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 27747926 |
| Molecular Formula | C15H15N3O4S2 |
| Molecular Weight | 365.44 g/mol |
| Exact Mass | 365.05 |
| IUPAC Name | [2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] 4-methyl-2-thiophen-2-yl-1,3-thiazole-5-carboxylate |
| SMILES | C=CCNC(=O)NC(=O)COC(=O)c1sc(-c2cccs2)nc1C |
| InChI | InChI=1S/C15H15N3O4S2/c1-3-6-16-15(21)18-11(19)8-22-14(20)12-9(2)17-13(24-12)10-5-4-7-23-10/h3-5,7H,1,6,8H2,2H3,(H2,16,18,19,21) |
| InChIKey | TWMMBCMHKREZIO-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.44 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|