C15H9BrFNO2S2 — CID 18285222
(4-bromo-2-fluorophenyl) 4-methyl-2-thiophen-2-yl-1,3-thiazole-5-carboxylate (PubChem CID 18285222) has the molecular formula C15H9BrFNO2S2 and a molecular weight of 398.28 g/mol. Its IUPAC name is (4-bromo-2-fluorophenyl) 4-methyl-2-thiophen-2-yl-1,3-thiazole-5-carboxylate.
| Compound Name | (4-bromo-2-fluorophenyl) 4-methyl-2-thiophen-2-yl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 18285222 |
| Molecular Formula | C15H9BrFNO2S2 |
| Molecular Weight | 398.28 g/mol |
| Exact Mass | 396.92 |
| IUPAC Name | (4-bromo-2-fluorophenyl) 4-methyl-2-thiophen-2-yl-1,3-thiazole-5-carboxylate |
| SMILES | Cc1nc(-c2cccs2)sc1C(=O)Oc1ccc(Br)cc1F |
| InChI | InChI=1S/C15H9BrFNO2S2/c1-8-13(22-14(18-8)12-3-2-6-21-12)15(19)20-11-5-4-9(16)7-10(11)17/h2-7H,1H3 |
| InChIKey | SDTVPSLZVKKYJW-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.28 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|