C15H11NO2S2 — CID 1474014
(5-methyl-2-thiophen-2-yl-1,3-thiazol-4-yl) benzoate (PubChem CID 1474014) has the molecular formula C15H11NO2S2 and a molecular weight of 301.39 g/mol. Its IUPAC name is (5-methyl-2-thiophen-2-yl-1,3-thiazol-4-yl) benzoate.
| Compound Name | (5-methyl-2-thiophen-2-yl-1,3-thiazol-4-yl) benzoate |
|---|---|
| PubChem CID | 1474014 |
| Molecular Formula | C15H11NO2S2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.02 |
| IUPAC Name | (5-methyl-2-thiophen-2-yl-1,3-thiazol-4-yl) benzoate |
| SMILES | Cc1sc(-c2cccs2)nc1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C15H11NO2S2/c1-10-13(16-14(20-10)12-8-5-9-19-12)18-15(17)11-6-3-2-4-7-11/h2-9H,1H3 |
| InChIKey | IICYOMJDFXXGBG-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |