C9H8ClNS2 — CID 82081726
5-(chloromethyl)-4-methyl-2-thiophen-2-yl-1,3-thiazole (PubChem CID 82081726) has the molecular formula C9H8ClNS2 and a molecular weight of 229.76 g/mol. Its IUPAC name is 5-(chloromethyl)-4-methyl-2-thiophen-2-yl-1,3-thiazole.
| Compound Name | 5-(chloromethyl)-4-methyl-2-thiophen-2-yl-1,3-thiazole |
|---|---|
| PubChem CID | 82081726 |
| Molecular Formula | C9H8ClNS2 |
| Molecular Weight | 229.76 g/mol |
| Exact Mass | 228.98 |
| IUPAC Name | 5-(chloromethyl)-4-methyl-2-thiophen-2-yl-1,3-thiazole |
| SMILES | Cc1nc(-c2cccs2)sc1CCl |
| InChI | InChI=1S/C9H8ClNS2/c1-6-8(5-10)13-9(11-6)7-3-2-4-12-7/h2-4H,5H2,1H3 |
| InChIKey | JWAACQIJQYWMFP-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.76 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|