C13H10ClNS3 — CID 28709881
5-(2-chloroethyl)-2,4-dithiophen-2-yl-1,3-thiazole (PubChem CID 28709881) has the molecular formula C13H10ClNS3 and a molecular weight of 311.88 g/mol. Its IUPAC name is 5-(2-chloroethyl)-2,4-dithiophen-2-yl-1,3-thiazole.
| Compound Name | 5-(2-chloroethyl)-2,4-dithiophen-2-yl-1,3-thiazole |
|---|---|
| PubChem CID | 28709881 |
| Molecular Formula | C13H10ClNS3 |
| Molecular Weight | 311.88 g/mol |
| Exact Mass | 310.97 |
| IUPAC Name | 5-(2-chloroethyl)-2,4-dithiophen-2-yl-1,3-thiazole |
| SMILES | ClCCc1sc(-c2cccs2)nc1-c1cccs1 |
| InChI | InChI=1S/C13H10ClNS3/c14-6-5-10-12(9-3-1-7-16-9)15-13(18-10)11-4-2-8-17-11/h1-4,7-8H,5-6H2 |
| InChIKey | VCSAVMGCRYKQGN-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.88 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|