C9H11ClN2S2 — CID 46736490
5-ethyl-4-thiophen-2-yl-1,3-thiazol-2-amine;hydrochloride (PubChem CID 46736490) has the molecular formula C9H11ClN2S2 and a molecular weight of 246.79 g/mol. Its IUPAC name is 5-ethyl-4-thiophen-2-yl-1,3-thiazol-2-amine;hydrochloride.
| Compound Name | 5-ethyl-4-thiophen-2-yl-1,3-thiazol-2-amine;hydrochloride |
|---|---|
| PubChem CID | 46736490 |
| Molecular Formula | C9H11ClN2S2 |
| Molecular Weight | 246.79 g/mol |
| Exact Mass | 246.01 |
| IUPAC Name | 5-ethyl-4-thiophen-2-yl-1,3-thiazol-2-amine;hydrochloride |
| SMILES | CCc1sc(N)nc1-c1cccs1.Cl |
| InChI | InChI=1S/C9H10N2S2.ClH/c1-2-6-8(11-9(10)13-6)7-4-3-5-12-7;/h3-5H,2H2,1H3,(H2,10,11);1H |
| InChIKey | QSTGMIJSGMAKQR-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.79 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |