C19H16N4OS2 — CID 110426528
3-(2-amino-4-thiophen-2-yl-1,3-thiazol-5-yl)-N-quinolin-8-ylpropanamide (PubChem CID 110426528) has the molecular formula C19H16N4OS2 and a molecular weight of 380.50 g/mol. Its IUPAC name is 3-(2-amino-4-thiophen-2-yl-1,3-thiazol-5-yl)-N-quinolin-8-ylpropanamide.
| Compound Name | 3-(2-amino-4-thiophen-2-yl-1,3-thiazol-5-yl)-N-quinolin-8-ylpropanamide |
|---|---|
| PubChem CID | 110426528 |
| Molecular Formula | C19H16N4OS2 |
| Molecular Weight | 380.50 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | 3-(2-amino-4-thiophen-2-yl-1,3-thiazol-5-yl)-N-quinolin-8-ylpropanamide |
| SMILES | Nc1nc(-c2cccs2)c(CCC(=O)Nc2cccc3cccnc23)s1 |
| InChI | InChI=1S/C19H16N4OS2/c20-19-23-18(14-7-3-11-25-14)15(26-19)8-9-16(24)22-13-6-1-4-12-5-2-10-21-17(12)13/h1-7,10-11H,8-9H2,(H2,20,23)(H,22,24) |
| InChIKey | HXQWMYDCMLPMPK-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.50 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |