C17H11N3OS2 — CID 17447095
N-quinolin-8-yl-2-thiophen-2-yl-1,3-thiazole-4-carboxamide (PubChem CID 17447095) has the molecular formula C17H11N3OS2 and a molecular weight of 337.43 g/mol. Its IUPAC name is N-quinolin-8-yl-2-thiophen-2-yl-1,3-thiazole-4-carboxamide.
| Compound Name | N-quinolin-8-yl-2-thiophen-2-yl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 17447095 |
| Molecular Formula | C17H11N3OS2 |
| Molecular Weight | 337.43 g/mol |
| Exact Mass | 337.03 |
| IUPAC Name | N-quinolin-8-yl-2-thiophen-2-yl-1,3-thiazole-4-carboxamide |
| SMILES | O=C(Nc1cccc2cccnc12)c1csc(-c2cccs2)n1 |
| InChI | InChI=1S/C17H11N3OS2/c21-16(13-10-23-17(20-13)14-7-3-9-22-14)19-12-6-1-4-11-5-2-8-18-15(11)12/h1-10H,(H,19,21) |
| InChIKey | GESVPTCLSUGWKY-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.43 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |