C18H13N5OS — CID 90509900
2-(pyridin-2-ylamino)-N-quinolin-8-yl-1,3-thiazole-4-carboxamide (PubChem CID 90509900) has the molecular formula C18H13N5OS and a molecular weight of 347.40 g/mol. Its IUPAC name is 2-(pyridin-2-ylamino)-N-quinolin-8-yl-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(pyridin-2-ylamino)-N-quinolin-8-yl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 90509900 |
| Molecular Formula | C18H13N5OS |
| Molecular Weight | 347.40 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | 2-(pyridin-2-ylamino)-N-quinolin-8-yl-1,3-thiazole-4-carboxamide |
| SMILES | O=C(Nc1cccc2cccnc12)c1csc(Nc2ccccn2)n1 |
| InChI | InChI=1S/C18H13N5OS/c24-17(21-13-7-3-5-12-6-4-10-20-16(12)13)14-11-25-18(22-14)23-15-8-1-2-9-19-15/h1-11H,(H,21,24)(H,19,22,23) |
| InChIKey | YQWYLGBJKHYOTQ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.40 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |