C13H9ClN6OS — CID 90506088
N-(2-chloro-3-pyridinyl)-2-(pyrimidin-2-ylamino)-1,3-thiazole-4-carboxamide (PubChem CID 90506088) has the molecular formula C13H9ClN6OS and a molecular weight of 332.78 g/mol. Its IUPAC name is N-(2-chloro-3-pyridinyl)-2-(pyrimidin-2-ylamino)-1,3-thiazole-4-carboxamide.
| Compound Name | N-(2-chloro-3-pyridinyl)-2-(pyrimidin-2-ylamino)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 90506088 |
| Molecular Formula | C13H9ClN6OS |
| Molecular Weight | 332.78 g/mol |
| Exact Mass | 332.02 |
| IUPAC Name | N-(2-chloro-3-pyridinyl)-2-(pyrimidin-2-ylamino)-1,3-thiazole-4-carboxamide |
| SMILES | O=C(Nc1cccnc1Cl)c1csc(Nc2ncccn2)n1 |
| InChI | InChI=1S/C13H9ClN6OS/c14-10-8(3-1-4-15-10)18-11(21)9-7-22-13(19-9)20-12-16-5-2-6-17-12/h1-7H,(H,18,21)(H,16,17,19,20) |
| InChIKey | BHIIFJVJXBXJDP-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 92.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.78 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|