C16H10ClF3N4OS — CID 58958517
2-[(2-chloro-3-pyridinyl)amino]-N-[4-(trifluoromethyl)phenyl]-1,3-thiazole-4-carboxamide (PubChem CID 58958517) has the molecular formula C16H10ClF3N4OS and a molecular weight of 398.80 g/mol. Its IUPAC name is 2-[(2-chloro-3-pyridinyl)amino]-N-[4-(trifluoromethyl)phenyl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[(2-chloro-3-pyridinyl)amino]-N-[4-(trifluoromethyl)phenyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 58958517 |
| Molecular Formula | C16H10ClF3N4OS |
| Molecular Weight | 398.80 g/mol |
| Exact Mass | 398.02 |
| IUPAC Name | 2-[(2-chloro-3-pyridinyl)amino]-N-[4-(trifluoromethyl)phenyl]-1,3-thiazole-4-carboxamide |
| SMILES | O=C(Nc1ccc(C(F)(F)F)cc1)c1csc(Nc2cccnc2Cl)n1 |
| InChI | InChI=1S/C16H10ClF3N4OS/c17-13-11(2-1-7-21-13)23-15-24-12(8-26-15)14(25)22-10-5-3-9(4-6-10)16(18,19)20/h1-8H,(H,22,25)(H,23,24) |
| InChIKey | BHKLSYHPBKRPRQ-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.80 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|