C15H16N2OS2 — CID 177007601
ethane;2-(4-methoxyphenyl)-5-thiophen-2-yl-1,3,4-thiadiazole (PubChem CID 177007601) has the molecular formula C15H16N2OS2 and a molecular weight of 304.44 g/mol. Its IUPAC name is ethane;2-(4-methoxyphenyl)-5-thiophen-2-yl-1,3,4-thiadiazole.
| Compound Name | ethane;2-(4-methoxyphenyl)-5-thiophen-2-yl-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 177007601 |
| Molecular Formula | C15H16N2OS2 |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | ethane;2-(4-methoxyphenyl)-5-thiophen-2-yl-1,3,4-thiadiazole |
| SMILES | CC.COc1ccc(-c2nnc(-c3cccs3)s2)cc1 |
| InChI | InChI=1S/C13H10N2OS2.C2H6/c1-16-10-6-4-9(5-7-10)12-14-15-13(18-12)11-3-2-8-17-11;1-2/h2-8H,1H3;1-2H3 |
| InChIKey | FMGJFRMHHAGGKT-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |