C16H11N3OS — CID 167877413
3-[5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-yl]benzonitrile (PubChem CID 167877413) has the molecular formula C16H11N3OS and a molecular weight of 293.35 g/mol. Its IUPAC name is 3-[5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-yl]benzonitrile.
| Compound Name | 3-[5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-yl]benzonitrile |
|---|---|
| PubChem CID | 167877413 |
| Molecular Formula | C16H11N3OS |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.06 |
| IUPAC Name | 3-[5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-yl]benzonitrile |
| SMILES | COc1ccc(-c2nnc(-c3cccc(C#N)c3)s2)cc1 |
| InChI | InChI=1S/C16H11N3OS/c1-20-14-7-5-12(6-8-14)15-18-19-16(21-15)13-4-2-3-11(9-13)10-17/h2-9H,1H3 |
| InChIKey | HZWZNRYBEJLJIT-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 58.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |