C16H20N2OS2 — CID 143241813
(E)-N-[(4-ethyl-2-thiophen-2-yl-1,3-thiazol-5-yl)methyl]-N-methylpent-2-enamide (PubChem CID 143241813) has the molecular formula C16H20N2OS2 and a molecular weight of 320.48 g/mol. Its IUPAC name is (E)-N-[(4-ethyl-2-thiophen-2-yl-1,3-thiazol-5-yl)methyl]-N-methylpent-2-enamide.
| Compound Name | (E)-N-[(4-ethyl-2-thiophen-2-yl-1,3-thiazol-5-yl)methyl]-N-methylpent-2-enamide |
|---|---|
| PubChem CID | 143241813 |
| Molecular Formula | C16H20N2OS2 |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | (E)-N-[(4-ethyl-2-thiophen-2-yl-1,3-thiazol-5-yl)methyl]-N-methylpent-2-enamide |
| SMILES | CC/C=C/C(=O)N(C)Cc1sc(-c2cccs2)nc1CC |
| InChI | InChI=1S/C16H20N2OS2/c1-4-6-9-15(19)18(3)11-14-12(5-2)17-16(21-14)13-8-7-10-20-13/h6-10H,4-5,11H2,1-3H3/b9-6+ |
| InChIKey | FBCRQHMNAPFXNM-RMKNXTFCSA-N |
| XLogP | 4.36 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|