C12H12N4S3 — CID 82430286
3-(4-ethyl-2-thiophen-2-yl-1,3-thiazol-5-yl)-4-methyl-1H-1,2,4-triazole-5-thione (PubChem CID 82430286) has the molecular formula C12H12N4S3 and a molecular weight of 308.46 g/mol. Its IUPAC name is 3-(4-ethyl-2-thiophen-2-yl-1,3-thiazol-5-yl)-4-methyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-(4-ethyl-2-thiophen-2-yl-1,3-thiazol-5-yl)-4-methyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 82430286 |
| Molecular Formula | C12H12N4S3 |
| Molecular Weight | 308.46 g/mol |
| Exact Mass | 308.02 |
| IUPAC Name | 3-(4-ethyl-2-thiophen-2-yl-1,3-thiazol-5-yl)-4-methyl-1H-1,2,4-triazole-5-thione |
| SMILES | CCc1nc(-c2cccs2)sc1-c1n[nH]c(=S)n1C |
| InChI | InChI=1S/C12H12N4S3/c1-3-7-9(10-14-15-12(17)16(10)2)19-11(13-7)8-5-4-6-18-8/h4-6H,3H2,1-2H3,(H,15,17) |
| InChIKey | LUTAAZJVTLLIJR-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.46 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|