C11H11N3OS — CID 70479920
4-ethyl-2-pyridin-4-yl-1,3-thiazole-5-carboxamide (PubChem CID 70479920) has the molecular formula C11H11N3OS and a molecular weight of 233.30 g/mol. Its IUPAC name is 4-ethyl-2-pyridin-4-yl-1,3-thiazole-5-carboxamide.
| Compound Name | 4-ethyl-2-pyridin-4-yl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 70479920 |
| Molecular Formula | C11H11N3OS |
| Molecular Weight | 233.30 g/mol |
| Exact Mass | 233.06 |
| IUPAC Name | 4-ethyl-2-pyridin-4-yl-1,3-thiazole-5-carboxamide |
| SMILES | CCc1nc(-c2ccncc2)sc1C(N)=O |
| InChI | InChI=1S/C11H11N3OS/c1-2-8-9(10(12)15)16-11(14-8)7-3-5-13-6-4-7/h3-6H,2H2,1H3,(H2,12,15) |
| InChIKey | RCXCEDCSAMHSQI-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.30 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |