C23H30N2OS — CID 143616512
4-butyl-N-methyl-2-(4-phenylmethoxyphenyl)-1,3-thiazol-5-amine;ethane (PubChem CID 143616512) has the molecular formula C23H30N2OS and a molecular weight of 382.57 g/mol. Its IUPAC name is 4-butyl-N-methyl-2-(4-phenylmethoxyphenyl)-1,3-thiazol-5-amine;ethane.
| Compound Name | 4-butyl-N-methyl-2-(4-phenylmethoxyphenyl)-1,3-thiazol-5-amine;ethane |
|---|---|
| PubChem CID | 143616512 |
| Molecular Formula | C23H30N2OS |
| Molecular Weight | 382.57 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | 4-butyl-N-methyl-2-(4-phenylmethoxyphenyl)-1,3-thiazol-5-amine;ethane |
| SMILES | CC.CCCCc1nc(-c2ccc(OCc3ccccc3)cc2)sc1NC |
| InChI | InChI=1S/C21H24N2OS.C2H6/c1-3-4-10-19-21(22-2)25-20(23-19)17-11-13-18(14-12-17)24-15-16-8-6-5-7-9-16;1-2/h5-9,11-14,22H,3-4,10,15H2,1-2H3;1-2H3 |
| InChIKey | AVOXVNUHLBXISJ-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.57 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |