C20H13Cl2N — CID 151613749
2,3-dichloro-4,5-diphenyl-1H-indole (PubChem CID 151613749) has the molecular formula C20H13Cl2N and a molecular weight of 338.24 g/mol. Its IUPAC name is 2,3-dichloro-4,5-diphenyl-1H-indole.
| Compound Name | 2,3-dichloro-4,5-diphenyl-1H-indole |
|---|---|
| PubChem CID | 151613749 |
| Molecular Formula | C20H13Cl2N |
| Molecular Weight | 338.24 g/mol |
| Exact Mass | 337.04 |
| IUPAC Name | 2,3-dichloro-4,5-diphenyl-1H-indole |
| SMILES | Clc1[nH]c2ccc(-c3ccccc3)c(-c3ccccc3)c2c1Cl |
| InChI | InChI=1S/C20H13Cl2N/c21-19-18-16(23-20(19)22)12-11-15(13-7-3-1-4-8-13)17(18)14-9-5-2-6-10-14/h1-12,23H |
| InChIKey | QNAZCBQGQGRLNY-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.24 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |