C22H18ClN — CID 172844821
2,3,4-triphenyl-1H-pyrrole;hydrochloride (PubChem CID 172844821) has the molecular formula C22H18ClN and a molecular weight of 331.85 g/mol. Its IUPAC name is 2,3,4-triphenyl-1H-pyrrole;hydrochloride.
| Compound Name | 2,3,4-triphenyl-1H-pyrrole;hydrochloride |
|---|---|
| PubChem CID | 172844821 |
| Molecular Formula | C22H18ClN |
| Molecular Weight | 331.85 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | 2,3,4-triphenyl-1H-pyrrole;hydrochloride |
| SMILES | Cl.c1ccc(-c2c[nH]c(-c3ccccc3)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C22H17N.ClH/c1-4-10-17(11-5-1)20-16-23-22(19-14-8-3-9-15-19)21(20)18-12-6-2-7-13-18;/h1-16,23H;1H |
| InChIKey | XGUCDMGVJKFOES-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.85 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |