C13H8N4OS — CID 2268937
2-amino-4-(3-hydroxyphenyl)-6-sulfanylidene-1H-pyridine-3,5-dicarbonitrile (PubChem CID 2268937) has the molecular formula C13H8N4OS and a molecular weight of 268.30 g/mol. Its IUPAC name is 2-amino-4-(3-hydroxyphenyl)-6-sulfanylidene-1H-pyridine-3,5-dicarbonitrile.
| Compound Name | 2-amino-4-(3-hydroxyphenyl)-6-sulfanylidene-1H-pyridine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 2268937 |
| Molecular Formula | C13H8N4OS |
| Molecular Weight | 268.30 g/mol |
| Exact Mass | 268.04 |
| IUPAC Name | 2-amino-4-(3-hydroxyphenyl)-6-sulfanylidene-1H-pyridine-3,5-dicarbonitrile |
| SMILES | N#Cc1c(N)[nH]c(=S)c(C#N)c1-c1cccc(O)c1 |
| InChI | InChI=1S/C13H8N4OS/c14-5-9-11(7-2-1-3-8(18)4-7)10(6-15)13(19)17-12(9)16/h1-4,18H,(H3,16,17,19) |
| InChIKey | WRBPNMFDZXBPJN-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.30 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_A(54)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|