C18H14N2O — CID 15398786
4-methoxy-2,5-diphenyl-1H-pyrrole-3-carbonitrile (PubChem CID 15398786) has the molecular formula C18H14N2O and a molecular weight of 274.32 g/mol. Its IUPAC name is 4-methoxy-2,5-diphenyl-1H-pyrrole-3-carbonitrile.
| Compound Name | 4-methoxy-2,5-diphenyl-1H-pyrrole-3-carbonitrile |
|---|---|
| PubChem CID | 15398786 |
| Molecular Formula | C18H14N2O |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 4-methoxy-2,5-diphenyl-1H-pyrrole-3-carbonitrile |
| SMILES | COc1c(-c2ccccc2)[nH]c(-c2ccccc2)c1C#N |
| InChI | InChI=1S/C18H14N2O/c1-21-18-15(12-19)16(13-8-4-2-5-9-13)20-17(18)14-10-6-3-7-11-14/h2-11,20H,1H3 |
| InChIKey | XCUOBXYNDNMXMI-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 48.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |