C19H15NO2 — CID 11077097
5,6-dimethoxy-2-phenylnaphthalene-1-carbonitrile (PubChem CID 11077097) has the molecular formula C19H15NO2 and a molecular weight of 289.33 g/mol. Its IUPAC name is 5,6-dimethoxy-2-phenylnaphthalene-1-carbonitrile.
| Compound Name | 5,6-dimethoxy-2-phenylnaphthalene-1-carbonitrile |
|---|---|
| PubChem CID | 11077097 |
| Molecular Formula | C19H15NO2 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 5,6-dimethoxy-2-phenylnaphthalene-1-carbonitrile |
| SMILES | COc1ccc2c(C#N)c(-c3ccccc3)ccc2c1OC |
| InChI | InChI=1S/C19H15NO2/c1-21-18-11-10-15-16(19(18)22-2)9-8-14(17(15)12-20)13-6-4-3-5-7-13/h3-11H,1-2H3 |
| InChIKey | GHUHVQHGFZNCCO-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |