C20H17NO2 — CID 71514389
6,7-dimethoxy-2-(3-methylphenyl)naphthalene-1-carbonitrile (PubChem CID 71514389) has the molecular formula C20H17NO2 and a molecular weight of 303.36 g/mol. Its IUPAC name is 6,7-dimethoxy-2-(3-methylphenyl)naphthalene-1-carbonitrile.
| Compound Name | 6,7-dimethoxy-2-(3-methylphenyl)naphthalene-1-carbonitrile |
|---|---|
| PubChem CID | 71514389 |
| Molecular Formula | C20H17NO2 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | 6,7-dimethoxy-2-(3-methylphenyl)naphthalene-1-carbonitrile |
| SMILES | COc1cc2ccc(-c3cccc(C)c3)c(C#N)c2cc1OC |
| InChI | InChI=1S/C20H17NO2/c1-13-5-4-6-14(9-13)16-8-7-15-10-19(22-2)20(23-3)11-17(15)18(16)12-21/h4-11H,1-3H3 |
| InChIKey | XIJQGEKVPUGGBX-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |